CAS 76385-50-7 is the registry number for 1,4-Dimethyl (2S)-2-(2-chloroacetamido)butanedioate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Dimethyl (2S)-2-[(2-chloroacetyl)amino]butanedioate (CAS 76385-50-7) is a chemical compound with the molecular formula C8H12ClNO5 and a molecular weight of 237.64 g/mol. IUPAC name: dimethyl (2S)-2-[(2-chloroacetyl)amino]butanedioate. InChIKey: CKYSSPLTBKXLFB-YFKPBYRVSA-N.
| Molecular formula | C8H12ClNO5 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | dimethyl (2S)-2-[(2-chloroacetyl)amino]butanedioate |
| InChIKey | CKYSSPLTBKXLFB-YFKPBYRVSA-N |
| SMILES | COC(=O)C[C@@H](C(=O)OC)NC(=O)CCl |
Computed by PubChem (NCBI)