Products 76385-54-1

CAS 76385-54-1 is the registry number for Glycyl Glutamine Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diethyl (2S)-2-[(2-chloroacetyl)amino]pentanedioate (CAS 76385-54-1) is a chemical compound with the molecular formula C11H18ClNO5 and a molecular weight of 279.72 g/mol. IUPAC name: diethyl (2S)-2-[(2-chloroacetyl)amino]pentanedioate. InChIKey: UPCBMASFNMAWND-QMMMGPOBSA-N.

Identity
Molecular formulaC11H18ClNO5
Molecular weight279.72 g/mol
IUPAC namediethyl (2S)-2-[(2-chloroacetyl)amino]pentanedioate
InChIKeyUPCBMASFNMAWND-QMMMGPOBSA-N
SMILESCCOC(=O)CC[C@@H](C(=O)OCC)NC(=O)CCl

Computed by PubChem (NCBI)