CAS 76397-22-3 is the registry number for 3-Chloro-3-(methyl-d3)-1-Butyne-4,4,4-d3. Offered by: TRC. Available pack sizes: 250mg.
3-chloro-4,4,4-trideuterio-3-(trideuteriomethyl)but-1-yne (CAS 76397-22-3) is a chemical compound with the molecular formula C5H7Cl and a molecular weight of 108.60 g/mol. IUPAC name: 3-chloro-4,4,4-trideuterio-3-(trideuteriomethyl)but-1-yne. InChIKey: QSILYWCNPOLKPN-XERRXZQWSA-N.
| Molecular formula | C5H7Cl |
|---|---|
| Molecular weight | 108.60 g/mol |
| IUPAC name | 3-chloro-4,4,4-trideuterio-3-(trideuteriomethyl)but-1-yne |
| InChIKey | QSILYWCNPOLKPN-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])C(C#C)(C([2H])([2H])[2H])Cl |
Computed by PubChem (NCBI)