CAS 76401-90-6 appears in our catalog under these names: Z-L-Threonine n-hydroxysuccinimide ester, 90%, Z–Thr–OSu. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 25g.
(2,5-dioxopyrrolidin-1-yl) (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate (CAS 76401-90-6) is a chemical compound with the molecular formula C16H18N2O7 and a molecular weight of 350.32 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: VTZRUMKJVGFNAZ-YGRLFVJLSA-N.
| Molecular formula | C16H18N2O7 |
|---|---|
| Molecular weight | 350.32 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | VTZRUMKJVGFNAZ-YGRLFVJLSA-N |
| SMILES | C[C@H]([C@@H](C(=O)ON1C(=O)CCC1=O)NC(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)