Products 76433-27-7
CAS 76433-27-7 is the registry number for Styryl 6. Offered by: MedChemExpress. Available pack sizes: Get quote.
N,N-dimethyl-4-[(1E,3E)-4-(1,3,3-trimethylindol-1-ium-2-yl)buta-1,3-dienyl]aniline perchlorate (CAS 76433-27-7) is a chemical compound with the molecular formula C23H27ClN2O4 and a molecular weight of 430.9 g/mol. IUPAC name: N,N-dimethyl-4-[(1E,3E)-4-(1,3,3-trimethylindol-1-ium-2-yl)buta-1,3-dienyl]aniline perchlorate. InChIKey: YEZRMIFMBREUKB-UHFFFAOYSA-M.
| Molecular formula | C23H27ClN2O4 |
|---|---|
| Molecular weight | 430.9 g/mol |
| IUPAC name | N,N-dimethyl-4-[(1E,3E)-4-(1,3,3-trimethylindol-1-ium-2-yl)buta-1,3-dienyl]aniline perchlorate |
| InChIKey | YEZRMIFMBREUKB-UHFFFAOYSA-M |
| SMILES | CC1(C2=CC=CC=C2[N+](=C1/C=C/C=C/C3=CC=C(C=C3)N(C)C)C)C.[O-]Cl(=O)(=O)=O |
Computed by PubChem (NCBI)