CAS 764600-87-5 appears in our catalog under these names: 1H-Indole-3-carboximidamide hydrochloride, 95%, 1H-Indole-3-carboximidamide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
1H-indole-3-carboximidamide (CAS 764600-87-5) is a chemical compound with the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. IUPAC name: 1H-indole-3-carboximidamide. InChIKey: JJURUVSVHQHERL-UHFFFAOYSA-N.
| Molecular formula | C9H9N3 |
|---|---|
| Molecular weight | 159.19 g/mol |
| IUPAC name | 1H-indole-3-carboximidamide |
| InChIKey | JJURUVSVHQHERL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=N)N |
Computed by PubChem (NCBI)