CAS 764650-43-3 is the registry number for 2-tert-Butyldimethylsilyloxyethanol-d4. Offered by: TRC. Available pack sizes: 100mg, 10mg.
2-[tert-butyl(dimethyl)silyl]oxy-1,1,2,2-tetradeuterioethanol (CAS 764650-43-3) is a chemical compound with the molecular formula C8H20O2Si and a molecular weight of 180.35 g/mol. IUPAC name: 2-[tert-butyl(dimethyl)silyl]oxy-1,1,2,2-tetradeuterioethanol. InChIKey: YJYAGNPMQVHYAH-KXGHAPEVSA-N.
| Molecular formula | C8H20O2Si |
|---|---|
| Molecular weight | 180.35 g/mol |
| IUPAC name | 2-[tert-butyl(dimethyl)silyl]oxy-1,1,2,2-tetradeuterioethanol |
| InChIKey | YJYAGNPMQVHYAH-KXGHAPEVSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O[Si](C)(C)C(C)(C)C)O |
Computed by PubChem (NCBI)