CAS 764660-71-1 is the registry number for N1,N5-Bis(4-(aminoiminomethyl)phenyl)pentanediamide. Offered by: TRC. Available pack sizes: 500mg.
N,N'-bis(4-carbamimidoylphenyl)pentanediamide (CAS 764660-71-1) is a chemical compound with the molecular formula C19H22N6O2 and a molecular weight of 366.4 g/mol. IUPAC name: N,N'-bis(4-carbamimidoylphenyl)pentanediamide. InChIKey: NXMXVZDGJTYBCO-UHFFFAOYSA-N.
| Molecular formula | C19H22N6O2 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | N,N'-bis(4-carbamimidoylphenyl)pentanediamide |
| InChIKey | NXMXVZDGJTYBCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=N)N)NC(=O)CCCC(=O)NC2=CC=C(C=C2)C(=N)N |
Computed by PubChem (NCBI)