CAS 764667-66-5 is the registry number for Sitagliptin Impurity 99. Offered by: Chemat Brand. Available pack sizes: on request.
5-[2-(2,5-difluorophenyl)-1-hydroxyethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 764667-66-5) is a chemical compound with the molecular formula C14H12F2O5 and a molecular weight of 298.24 g/mol. IUPAC name: 5-[2-(2,5-difluorophenyl)-1-hydroxyethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: VUMCSZLCGHLOLQ-UHFFFAOYSA-N.
| Molecular formula | C14H12F2O5 |
|---|---|
| Molecular weight | 298.24 g/mol |
| IUPAC name | 5-[2-(2,5-difluorophenyl)-1-hydroxyethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | VUMCSZLCGHLOLQ-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=C(CC2=C(C=CC(=C2)F)F)O)C(=O)O1)C |
Computed by PubChem (NCBI)