CAS 76472-28-1 is the registry number for Ono 3307 (free base). Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-sulfamoylphenyl) 4-(diaminomethylideneamino)benzoate (CAS 76472-28-1) is a chemical compound with the molecular formula C14H14N4O4S and a molecular weight of 334.35 g/mol. IUPAC name: (4-sulfamoylphenyl) 4-(diaminomethylideneamino)benzoate. InChIKey: YFUQTMNUQVFBBS-UHFFFAOYSA-N.
| Molecular formula | C14H14N4O4S |
|---|---|
| Molecular weight | 334.35 g/mol |
| IUPAC name | (4-sulfamoylphenyl) 4-(diaminomethylideneamino)benzoate |
| InChIKey | YFUQTMNUQVFBBS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OC2=CC=C(C=C2)S(=O)(=O)N)N=C(N)N |
Computed by PubChem (NCBI)