CAS 76487-51-9 appears in our catalog under these names: N-Acetyl-9-azido-9-deoxyneuraminic Acid, N-Acetyl-9-azido-9-deoxy-neuraminic acid, N-Acetyl-9-azido-9-deoxy-neuraminic acid, 90.00%, N-Acetyl-9-azido-9-deoxy-neuraminic acid, 5 mg, N-Acetyl-9-azido-9-deoxy-neuraminic acid, 10 mg. Offered by: TRC, TCI, Biosynth, Chemat, Roth. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 1mg, 25 mg, 50 mg.
(4S,5R,6R,7R,8R)-5-acetamido-9-azido-4,6,7,8-tetrahydroxy-2-oxononanoic acid (CAS 76487-51-9) is a chemical compound with the molecular formula C11H18N4O8 and a molecular weight of 334.28 g/mol. IUPAC name: (4S,5R,6R,7R,8R)-5-acetamido-9-azido-4,6,7,8-tetrahydroxy-2-oxononanoic acid. InChIKey: RCMJNJVGOFCOSP-BOHATCBPSA-N.
| Molecular formula | C11H18N4O8 |
|---|---|
| Molecular weight | 334.28 g/mol |
| IUPAC name | (4S,5R,6R,7R,8R)-5-acetamido-9-azido-4,6,7,8-tetrahydroxy-2-oxononanoic acid |
| InChIKey | RCMJNJVGOFCOSP-BOHATCBPSA-N |
| SMILES | CC(=O)N[C@H]([C@H](CC(=O)C(=O)O)O)[C@H]([C@@H]([C@@H](CN=[N+]=[N-])O)O)O |
Computed by PubChem (NCBI)