Products 76496-68-9
CAS 76496-68-9 is the registry number for R-(-)-Oxaprotiline. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R)-1-(methylamino)-3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propan-2-ol (CAS 76496-68-9) is a chemical compound with the molecular formula C20H23NO and a molecular weight of 293.4 g/mol. IUPAC name: (2R)-1-(methylamino)-3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propan-2-ol. InChIKey: FDXQKWSTUZCCTM-ZUIJCZDSSA-N.
| Molecular formula | C20H23NO |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | (2R)-1-(methylamino)-3-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)propan-2-ol |
| InChIKey | FDXQKWSTUZCCTM-ZUIJCZDSSA-N |
| SMILES | CNC[C@@H](CC12CCC(C3=CC=CC=C31)C4=CC=CC=C24)O |
Computed by PubChem (NCBI)