CAS 7653-68-1 is the registry number for 2,5-Bis(methylsulfonyl)-1,3,4-thiadiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-bis(methylsulfonyl)-1,3,4-thiadiazole (CAS 7653-68-1) is a chemical compound with the molecular formula C4H6N2O4S3 and a molecular weight of 242.3 g/mol. IUPAC name: 2,5-bis(methylsulfonyl)-1,3,4-thiadiazole. InChIKey: NMRDWXDZQQIHQU-UHFFFAOYSA-N.
| Molecular formula | C4H6N2O4S3 |
|---|---|
| Molecular weight | 242.3 g/mol |
| IUPAC name | 2,5-bis(methylsulfonyl)-1,3,4-thiadiazole |
| InChIKey | NMRDWXDZQQIHQU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NN=C(S1)S(=O)(=O)C |
Computed by PubChem (NCBI)