CAS 76549-02-5 appears in our catalog under these names: (2S,3S)-3-Hydroxy-2-methyl-3-phenylpropanoic acid, 98%, (2S,3S)-3-Hydroxy-2-methyl-3-phenylpropanoic acid/ 99.59% (existing batch purity), (2S,3S)-3-hydroxy-2-methyl-3-phenylpropanoic acid. Offered by: AmBeed, TargetMol, Chemat. Available pack sizes: 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S,3S)-3-hydroxy-2-methyl-3-phenylpropanoic acid (CAS 76549-02-5) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: (2S,3S)-3-hydroxy-2-methyl-3-phenylpropanoic acid. InChIKey: JWISPMMVFLKFMW-CBAPKCEASA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | (2S,3S)-3-hydroxy-2-methyl-3-phenylpropanoic acid |
| InChIKey | JWISPMMVFLKFMW-CBAPKCEASA-N |
| SMILES | C[C@@H]([C@@H](C1=CC=CC=C1)O)C(=O)O |
Computed by PubChem (NCBI)