CAS 76579-44-7 appears in our catalog under these names: 1-[4-(2,2,2-Trifluoroethoxy)phenyl]ethan-1-one, 95%, 1-(4-(2,2,2-Trifluoroethoxy)phenyl)ethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 2,5g.
1-[4-(2,2,2-trifluoroethoxy)phenyl]ethanone (CAS 76579-44-7) is a chemical compound with the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. IUPAC name: 1-[4-(2,2,2-trifluoroethoxy)phenyl]ethanone. InChIKey: WLTPFXQNFLAKQT-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O2 |
|---|---|
| Molecular weight | 218.17 g/mol |
| IUPAC name | 1-[4-(2,2,2-trifluoroethoxy)phenyl]ethanone |
| InChIKey | WLTPFXQNFLAKQT-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)OCC(F)(F)F |
Computed by PubChem (NCBI)