CAS 7658-08-4 appears in our catalog under these names: 6-Deoxy-D-glucose, min. 95 %, 200 mg, 6-Deoxy-d-glucose, 95%, 6-Deoxy-D-Glucose, 6-Deoxy-D-glucose, 98.00%, 6-DEOXY-D-GLUCOSE CRYSTALLINE. Offered by: Roth, Combi-blocks, TRC, Chemat, Sigma-Aldrich. Available pack sizes: 200mg, 250mg, 100mg, 1g, 10mg, 500mg, 50 mg, 100 mg.
(3R,4S,5S,6R)-6-methyloxane-2,3,4,5-tetrol (CAS 7658-08-4) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (3R,4S,5S,6R)-6-methyloxane-2,3,4,5-tetrol. InChIKey: SHZGCJCMOBCMKK-GASJEMHNSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (3R,4S,5S,6R)-6-methyloxane-2,3,4,5-tetrol |
| InChIKey | SHZGCJCMOBCMKK-GASJEMHNSA-N |
| SMILES | C[C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O |
Computed by PubChem (NCBI)