Products 7658-10-8
CAS 7658-10-8 appears in our catalog under these names: 6–deoxy–L–Talose, 6-Deoxy-L-talose, 10 mg, (2R,3R,4R,5S)-2,3,4,5-Tetrahydroxyhexanal, 98%, 6-Deoxy-L-talose, >95% (HPLC), 6-Deoxy-L-talose. Offered by: GLPBio, Roth, Chemat Brand, TRC, Biosynth. Available pack sizes: 10mg, on request, 5mg, 1mg, 25mg, 100mg, 50mg, 5 mg.
(2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanal (CAS 7658-10-8) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanal. InChIKey: PNNNRSAQSRJVSB-ARQDHWQXSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2S,3S,4S,5R)-2,3,4,5-tetrahydroxyhexanal |
| InChIKey | PNNNRSAQSRJVSB-ARQDHWQXSA-N |
| SMILES | C[C@H]([C@@H]([C@@H]([C@@H](C=O)O)O)O)O |
Computed by PubChem (NCBI)