CAS 7662-40-0 is the registry number for O-Hippuryl-DL-b-phenyllactic acid sodium salt. Offered by: Biosynth. Available pack sizes: 5000mg, 2000mg, 10000mg.
Sodium 2-(2-benzamidoacetyl)oxy-3-phenylpropanoate (CAS 7662-40-0) is a chemical compound with the molecular formula C18H16NNaO5 and a molecular weight of 349.3 g/mol. IUPAC name: sodium 2-(2-benzamidoacetyl)oxy-3-phenylpropanoate. InChIKey: JKYQSWBXUUFAAL-UHFFFAOYSA-M.
| Molecular formula | C18H16NNaO5 |
|---|---|
| Molecular weight | 349.3 g/mol |
| IUPAC name | sodium 2-(2-benzamidoacetyl)oxy-3-phenylpropanoate |
| InChIKey | JKYQSWBXUUFAAL-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)CC(C(=O)[O-])OC(=O)CNC(=O)C2=CC=CC=C2.[Na+] |
Computed by PubChem (NCBI)