CAS 76647-70-6 is the registry number for 5-Deoxy-L-arabonic acid 1,4-lactone. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 2000mg, 1000mg.
(3R,4R,5S)-3,4-dihydroxy-5-methyloxolan-2-one (CAS 76647-70-6) is a chemical compound with the molecular formula C5H8O4 and a molecular weight of 132.11 g/mol. IUPAC name: (3R,4R,5S)-3,4-dihydroxy-5-methyloxolan-2-one. InChIKey: JYHWQRJRDKSSIF-YVZJFKFKSA-N.
| Molecular formula | C5H8O4 |
|---|---|
| Molecular weight | 132.11 g/mol |
| IUPAC name | (3R,4R,5S)-3,4-dihydroxy-5-methyloxolan-2-one |
| InChIKey | JYHWQRJRDKSSIF-YVZJFKFKSA-N |
| SMILES | C[C@H]1[C@@H]([C@H](C(=O)O1)O)O |
Computed by PubChem (NCBI)