CAS 76674-58-3 appears in our catalog under these names: 2-(4-tert-Butylphenoxy)-2-methylpropanoic acid, 95%, 2-(4-tert-Butylphenoxy)-2-methylpropanoic acid, 2-(4-tert-Butyl-phenoxy)-2-methyl-propionic acid, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 0,25g, 0,5g.
2-(4-tert-butylphenoxy)-2-methylpropanoic acid (CAS 76674-58-3) is a chemical compound with the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. IUPAC name: 2-(4-tert-butylphenoxy)-2-methylpropanoic acid. InChIKey: MINZYOMFMKWNIN-UHFFFAOYSA-N.
| Molecular formula | C14H20O3 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | 2-(4-tert-butylphenoxy)-2-methylpropanoic acid |
| InChIKey | MINZYOMFMKWNIN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OC(C)(C)C(=O)O |
Computed by PubChem (NCBI)