CAS 76686-93-6 is the registry number for 2-(5-Chloro-1,3,4-thiadiazol-2-yl)pyridine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-chloro-5-pyridin-2-yl-1,3,4-thiadiazole (CAS 76686-93-6) is a chemical compound with the molecular formula C7H4ClN3S and a molecular weight of 197.65 g/mol. IUPAC name: 2-chloro-5-pyridin-2-yl-1,3,4-thiadiazole. InChIKey: VPOZQSSIKSLQPA-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3S |
|---|---|
| Molecular weight | 197.65 g/mol |
| IUPAC name | 2-chloro-5-pyridin-2-yl-1,3,4-thiadiazole |
| InChIKey | VPOZQSSIKSLQPA-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NN=C(S2)Cl |
Computed by PubChem (NCBI)