CAS 767-13-5 appears in our catalog under these names: cis,cis-3,5-Dimethylcyclohexanol, (1s,3R,5S)-rel-3,5-Dimethylcyclohexan-1-ol 97%, (1s,3R,5S)-3,5-dimethylcyclohexan-1-ol, 97%, 97%. Offered by: TRC, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g, 25g, 500mg, 10g, 50g.
Cis-(3S,5R)-3,5-dimethylcyclohexan-1-ol (CAS 767-13-5) is a chemical compound with the molecular formula C8H16O and a molecular weight of 128.21 g/mol. IUPAC name: cis-(3S,5R)-3,5-dimethylcyclohexan-1-ol. InChIKey: WIYNOPYNRFPWNB-DHBOJHSNSA-N.
| Molecular formula | C8H16O |
|---|---|
| Molecular weight | 128.21 g/mol |
| IUPAC name | cis-(3S,5R)-3,5-dimethylcyclohexan-1-ol |
| InChIKey | WIYNOPYNRFPWNB-DHBOJHSNSA-N |
| SMILES | C[C@@H]1C[C@@H](CC(C1)O)C |
Computed by PubChem (NCBI)