Products 767-54-4
CAS 767-54-4 appears in our catalog under these names: Trans-3,3,5-trimethylcyclohexanol, 95%, trans–3，3，5–Trimethylcyclohexanol, trans-3,3,5-Trimethylcyclohexanol, >95.0%(GC), Trans-3,3,5-trimethylcyclohexanol, 95%+,RG, 95%+,RG. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 5g, 25g, 1g.
Trans-(1R,5S)-3,3,5-trimethylcyclohexan-1-ol (CAS 767-54-4) is a chemical compound with the molecular formula C9H18O and a molecular weight of 142.24 g/mol. IUPAC name: trans-(1R,5S)-3,3,5-trimethylcyclohexan-1-ol. InChIKey: BRRVXFOKWJKTGG-HTQZYQBOSA-N.
| Molecular formula | C9H18O |
|---|---|
| Molecular weight | 142.24 g/mol |
| IUPAC name | trans-(1R,5S)-3,3,5-trimethylcyclohexan-1-ol |
| InChIKey | BRRVXFOKWJKTGG-HTQZYQBOSA-N |
| SMILES | C[C@@H]1C[C@H](CC(C1)(C)C)O |
Computed by PubChem (NCBI)