Products 767-71-5
CAS 767-71-5 appears in our catalog under these names: N,2,6-Trimethylaniline, 95%, N，2，6-Trimethylaniline, 95%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
N,2,6-trimethylaniline (CAS 767-71-5) is a chemical compound with the molecular formula C9H13N and a molecular weight of 135.21 g/mol. IUPAC name: N,2,6-trimethylaniline. InChIKey: NLGKRVNANIZGNI-UHFFFAOYSA-N.
| Molecular formula | C9H13N |
|---|---|
| Molecular weight | 135.21 g/mol |
| IUPAC name | N,2,6-trimethylaniline |
| InChIKey | NLGKRVNANIZGNI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC |
Computed by PubChem (NCBI)
Synonyms:
N,2,6-trimethylaniline, N,2,6-Trimethylbenzenamine, benzenamine, N,2,6-trimethyl-, InChI=1/C9H13N/c1-7-5-4-6-8(2)9(7)10-3/h4-6,10H,1-3H, Benzenamine,N,2,6-trimethyl-, aniline, N,2,6-trimethyl-, (2,6-dimethylphenyl)methylamine, N-methyl-2,6-dimethylaniline, N26-Trimethylaniline, N-methyl-2,6-xylidine