Products 767299-99-0

CAS 767299-99-0 is the registry number for AP-503, 99.84%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 100 mg, 50 mg, 25 mg, 10 mg, 5 mg.

Structural formula: {0} (CAS {1})

Methyl 3-[[2-(2,4-dimethylphenoxy)acetyl]amino]-4-(4-ethylpiperazin-1-yl)benzoate (CAS 767299-99-0) is a chemical compound with the molecular formula C24H31N3O4 and a molecular weight of 425.5 g/mol. IUPAC name: methyl 3-[[2-(2,4-dimethylphenoxy)acetyl]amino]-4-(4-ethylpiperazin-1-yl)benzoate. InChIKey: CPGGKKARFZXWMR-UHFFFAOYSA-N.

Identity
Molecular formulaC24H31N3O4
Molecular weight425.5 g/mol
IUPAC namemethyl 3-[[2-(2,4-dimethylphenoxy)acetyl]amino]-4-(4-ethylpiperazin-1-yl)benzoate
InChIKeyCPGGKKARFZXWMR-UHFFFAOYSA-N
SMILESCCN1CCN(CC1)C2=C(C=C(C=C2)C(=O)OC)NC(=O)COC3=C(C=C(C=C3)C)C

Computed by PubChem (NCBI)