CAS 7673-09-8 appears in our catalog under these names: Trichloromelamine, 95%, Trichloromelamine, >95.0%(T), 1,3,5-Triazine-2,4,6-triamine, N2,N4,N6-trichloro-, 95%, 95%. Offered by: Combi-blocks, TCI, Chemat. Available pack sizes: 5g, 500g, 100g, 25g, 1g.
2-N,4-N,6-N-trichloro-1,3,5-triazine-2,4,6-triamine (CAS 7673-09-8) is a chemical compound with the molecular formula C3H3Cl3N6 and a molecular weight of 229.45 g/mol. IUPAC name: 2-N,4-N,6-N-trichloro-1,3,5-triazine-2,4,6-triamine. InChIKey: KEPNSIARSTUPGS-UHFFFAOYSA-N.
| Molecular formula | C3H3Cl3N6 |
|---|---|
| Molecular weight | 229.45 g/mol |
| IUPAC name | 2-N,4-N,6-N-trichloro-1,3,5-triazine-2,4,6-triamine |
| InChIKey | KEPNSIARSTUPGS-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NC(=N1)NCl)NCl)NCl |
Computed by PubChem (NCBI)