CAS 7675-57-2 appears in our catalog under these names: N–2–Nitrophenylsulfenyl–L–valine Dicyclohexylammonium Salt, Nps-Val-OH · DCHA, Nps-Val-OH·DCHA. Offered by: GLPBio, Creative Peptides, Biosynth. Available pack sizes: 1g, 5g, 25g, 10g, 50g, 100g.
N-cyclohexylcyclohexanamine;(2S)-3-methyl-2-[(2-nitrophenyl)sulfanylamino]butanoic acid (CAS 7675-57-2) is a chemical compound with the molecular formula C23H37N3O4S and a molecular weight of 451.6 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2S)-3-methyl-2-[(2-nitrophenyl)sulfanylamino]butanoic acid. InChIKey: PIXHCLWIWCGYKF-CICJTZRQSA-N.
| Molecular formula | C23H37N3O4S |
|---|---|
| Molecular weight | 451.6 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2S)-3-methyl-2-[(2-nitrophenyl)sulfanylamino]butanoic acid |
| InChIKey | PIXHCLWIWCGYKF-CICJTZRQSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NSC1=CC=CC=C1[N+](=O)[O-].C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)