CAS 7675-59-4 is the registry number for Dicyclohexylamine ((2-nitrophenyl)thio)-L-asparaginate, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-4-amino-2-[(2-nitrophenyl)sulfanylamino]-4-oxobutanoic acid;N-cyclohexylcyclohexanamine (CAS 7675-59-4) is a chemical compound with the molecular formula C22H34N4O5S and a molecular weight of 466.6 g/mol. IUPAC name: (2S)-4-amino-2-[(2-nitrophenyl)sulfanylamino]-4-oxobutanoic acid;N-cyclohexylcyclohexanamine. InChIKey: VAEHYJPYTMRQNC-ZCMDIHMWSA-N.
| Molecular formula | C22H34N4O5S |
|---|---|
| Molecular weight | 466.6 g/mol |
| IUPAC name | (2S)-4-amino-2-[(2-nitrophenyl)sulfanylamino]-4-oxobutanoic acid;N-cyclohexylcyclohexanamine |
| InChIKey | VAEHYJPYTMRQNC-ZCMDIHMWSA-N |
| SMILES | C1CCC(CC1)NC2CCCCC2.C1=CC=C(C(=C1)[N+](=O)[O-])SN[C@@H](CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)