CAS 7675-83-4 appears in our catalog under these names: L-Arginine L-Aspartate, L-Arginine L-Aspartate, >95% (HPLC), Arginine Aspartate (L-Arginine L-Aspartate), L–Arginine L–aspartate, L-Arginine L-aspartate, 98.00%. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Mikromol, GLPBio. Available pack sizes: on request, 100mg, 1g, 250mg, 500g, 0,25kg, 0,1kg, 100g.
(2S)-2-aminobutanedioic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid (CAS 7675-83-4) is a chemical compound with the molecular formula C10H21N5O6 and a molecular weight of 307.30 g/mol. IUPAC name: (2S)-2-aminobutanedioic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid. InChIKey: SUUWYOYAXFUOLX-ZBRNBAAYSA-N.
| Molecular formula | C10H21N5O6 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | (2S)-2-aminobutanedioic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid |
| InChIKey | SUUWYOYAXFUOLX-ZBRNBAAYSA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CN=C(N)N.C([C@@H](C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)