CAS 767571-29-9 is the registry number for 1-Benzyl-1H-imidazol-4-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-benzylimidazol-4-amine (CAS 767571-29-9) is a chemical compound with the molecular formula C10H11N3 and a molecular weight of 173.21 g/mol. IUPAC name: 1-benzylimidazol-4-amine. InChIKey: XHUPXWTZLUZOGM-UHFFFAOYSA-N.
| Molecular formula | C10H11N3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 1-benzylimidazol-4-amine |
| InChIKey | XHUPXWTZLUZOGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(N=C2)N |
Computed by PubChem (NCBI)