CAS 936940-08-8 appears in our catalog under these names: [(5-Phenyl-1h-pyrazol-3-yl)methyl]amine, 96%, [(5-Phenyl-1h-pyrazol-3-yl)methyl]amine hydrochloride, 98%, 3–(Aminomethyl)–5–phenylpyrazole. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 10g, 1g, 250mg.
(3-phenyl-1H-pyrazol-5-yl)methanamine (CAS 936940-08-8) is a chemical compound with the molecular formula C10H11N3 and a molecular weight of 173.21 g/mol. IUPAC name: (3-phenyl-1H-pyrazol-5-yl)methanamine. InChIKey: SZLBOMHYJMAXRA-UHFFFAOYSA-N.
| Molecular formula | C10H11N3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | (3-phenyl-1H-pyrazol-5-yl)methanamine |
| InChIKey | SZLBOMHYJMAXRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=C2)CN |
Computed by PubChem (NCBI)