Products 76780-22-8
CAS 76780-22-8 is the registry number for 1-(3-Bromopropyl)-4-methylpyridin-1-ium bromide, 98%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(3-bromopropyl)-4-methylpyridin-1-ium bromide (CAS 76780-22-8) is a chemical compound with the molecular formula C9H13Br2N and a molecular weight of 295.01 g/mol. IUPAC name: 1-(3-bromopropyl)-4-methylpyridin-1-ium bromide. InChIKey: ZGFNOZBLIVXFMY-UHFFFAOYSA-M.
| Molecular formula | C9H13Br2N |
|---|---|
| Molecular weight | 295.01 g/mol |
| IUPAC name | 1-(3-bromopropyl)-4-methylpyridin-1-ium bromide |
| InChIKey | ZGFNOZBLIVXFMY-UHFFFAOYSA-M |
| SMILES | CC1=CC=[N+](C=C1)CCCBr.[Br-] |
Computed by PubChem (NCBI)