Products 7680-58-2

CAS 7680-58-2 is the registry number for 4-Carboxy-1-methylpyridin-1-ium iodide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-methylpyridin-1-ium-4-carboxylic acid iodide (CAS 7680-58-2) is a chemical compound with the molecular formula C7H8INO2 and a molecular weight of 265.05 g/mol. IUPAC name: 1-methylpyridin-1-ium-4-carboxylic acid iodide. InChIKey: NTLJUNJJEIPZGA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8INO2
Molecular weight265.05 g/mol
IUPAC name1-methylpyridin-1-ium-4-carboxylic acid iodide
InChIKeyNTLJUNJJEIPZGA-UHFFFAOYSA-N
SMILESC[N+]1=CC=C(C=C1)C(=O)O.[I-]

Computed by PubChem (NCBI)