CAS 7680-58-2 is the registry number for 4-Carboxy-1-methylpyridin-1-ium iodide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-methylpyridin-1-ium-4-carboxylic acid iodide (CAS 7680-58-2) is a chemical compound with the molecular formula C7H8INO2 and a molecular weight of 265.05 g/mol. IUPAC name: 1-methylpyridin-1-ium-4-carboxylic acid iodide. InChIKey: NTLJUNJJEIPZGA-UHFFFAOYSA-N.
| Molecular formula | C7H8INO2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | 1-methylpyridin-1-ium-4-carboxylic acid iodide |
| InChIKey | NTLJUNJJEIPZGA-UHFFFAOYSA-N |
| SMILES | C[N+]1=CC=C(C=C1)C(=O)O.[I-] |
Computed by PubChem (NCBI)