CAS 7681-78-9 is the registry number for Mebezonium Iodide. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 100mg, 1g, 50mg, 10mg.
Trimethyl-[4-[[4-(trimethylazaniumyl)cyclohexyl]methyl]cyclohexyl]azanium diiodide (CAS 7681-78-9) is a chemical compound with the molecular formula C19H40I2N2 and a molecular weight of 550.3 g/mol. IUPAC name: trimethyl-[4-[[4-(trimethylazaniumyl)cyclohexyl]methyl]cyclohexyl]azanium diiodide. InChIKey: CWPAAKNARYMZLM-UHFFFAOYSA-L.
| Molecular formula | C19H40I2N2 |
|---|---|
| Molecular weight | 550.3 g/mol |
| IUPAC name | trimethyl-[4-[[4-(trimethylazaniumyl)cyclohexyl]methyl]cyclohexyl]azanium diiodide |
| InChIKey | CWPAAKNARYMZLM-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)C1CCC(CC1)CC2CCC(CC2)[N+](C)(C)C.[I-].[I-] |
Computed by PubChem (NCBI)