CAS 76812-43-6 is the registry number for Acemetacin Ethyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.
(2-ethoxy-2-oxoethyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (CAS 76812-43-6) is a chemical compound with the molecular formula C23H22ClNO6 and a molecular weight of 443.9 g/mol. IUPAC name: (2-ethoxy-2-oxoethyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate. InChIKey: LJPQBEUXEDLQEJ-UHFFFAOYSA-N.
| Molecular formula | C23H22ClNO6 |
|---|---|
| Molecular weight | 443.9 g/mol |
| IUPAC name | (2-ethoxy-2-oxoethyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| InChIKey | LJPQBEUXEDLQEJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC(=O)CC1=C(N(C2=C1C=C(C=C2)OC)C(=O)C3=CC=C(C=C3)Cl)C |
Computed by PubChem (NCBI)