Products 768335-42-8(free base)

CAS 768335-42-8(free base) is the registry number for Methisosildenafil Impurity 23. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(2R,6R)-2,6-dimethylpiperazine (CAS 768335-42-8) is a chemical compound with the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. IUPAC name: (2R,6R)-2,6-dimethylpiperazine. InChIKey: IFNWESYYDINUHV-PHDIDXHHSA-N.

Identity
Molecular formulaC6H14N2
Molecular weight114.19 g/mol
IUPAC name(2R,6R)-2,6-dimethylpiperazine
InChIKeyIFNWESYYDINUHV-PHDIDXHHSA-N
SMILESC[C@@H]1CNC[C@H](N1)C

Computed by PubChem (NCBI)