CAS 76835-16-0 appears in our catalog under these names: 1–(3,5–Dichlorophenyl)–piperazine hydrochloride, 1-(3,5-Dichlorophenyl)-piperazine hydrochloride. Offered by: GLPBio, Biosynth. Available pack sizes: 500mg, 5000mg, 10000mg.
1-(3,5-dichlorophenyl)piperazine;dihydrochloride (CAS 76835-16-0) is a chemical compound with the molecular formula C10H14Cl4N2 and a molecular weight of 304.0 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)piperazine;dihydrochloride. InChIKey: TYHHRQZMKLYRLC-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl4N2 |
|---|---|
| Molecular weight | 304.0 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)piperazine;dihydrochloride |
| InChIKey | TYHHRQZMKLYRLC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=CC(=C2)Cl)Cl.Cl.Cl |
Computed by PubChem (NCBI)