CAS 76863-28-0 appears in our catalog under these names: Fluorescein-5-thiosemicarbazide, Fluorescein–5–thiosemicarbazide, Fluorescein-5-thiosemicarbazide hydrochloride, Fluorescein-5-thiosemicarbazide 95%, FLUORESCEIN-5-THIOSEMICARBAZIDE SUITABL&. Offered by: TRC, GLPBio, Chemat, Biosynth, Ambeed. Available pack sizes: 25mg, 100mg, 500mg, 50mg, 250mg, 10000mg, 10mg, 5 mg.
5-(aminocarbamothioylamino)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (CAS 76863-28-0) is a chemical compound with the molecular formula C21H15N3O5S and a molecular weight of 421.4 g/mol. IUPAC name: 5-(aminocarbamothioylamino)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid. InChIKey: MEUCHQDLZYLNQY-UHFFFAOYSA-N.
| Molecular formula | C21H15N3O5S |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | 5-(aminocarbamothioylamino)-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| InChIKey | MEUCHQDLZYLNQY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=S)NN)C(=O)O)C2=C3C=CC(=O)C=C3OC4=C2C=CC(=C4)O |
Computed by PubChem (NCBI)