CAS 76881-19-1 is the registry number for 5,5-Dimethyl-3-trifluoromethylsulfonyloxycyclohex-2-en-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
(5,5-dimethyl-3-oxocyclohexen-1-yl) trifluoromethanesulfonate (CAS 76881-19-1) is a chemical compound with the molecular formula C9H11F3O4S and a molecular weight of 272.24 g/mol. IUPAC name: (5,5-dimethyl-3-oxocyclohexen-1-yl) trifluoromethanesulfonate. InChIKey: UINBCLOSQYROKH-UHFFFAOYSA-N.
| Molecular formula | C9H11F3O4S |
|---|---|
| Molecular weight | 272.24 g/mol |
| IUPAC name | (5,5-dimethyl-3-oxocyclohexen-1-yl) trifluoromethanesulfonate |
| InChIKey | UINBCLOSQYROKH-UHFFFAOYSA-N |
| SMILES | CC1(CC(=CC(=O)C1)OS(=O)(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)