Products 769-06-2
CAS 769-06-2 is the registry number for N,N,2,6-Tetramethylaniline, 95%. Offered by: BLDpharm. Available pack sizes: 50mg, 100mg, 250mg.
N,N,2,6-tetramethylaniline (CAS 769-06-2) is a chemical compound with the molecular formula C10H15N and a molecular weight of 149.23 g/mol. IUPAC name: N,N,2,6-tetramethylaniline. InChIKey: SCVRZFQSPISLTD-UHFFFAOYSA-N.
| Molecular formula | C10H15N |
|---|---|
| Molecular weight | 149.23 g/mol |
| IUPAC name | N,N,2,6-tetramethylaniline |
| InChIKey | SCVRZFQSPISLTD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N(C)C |
Computed by PubChem (NCBI)
Synonyms:
N,N,2,6-Tetramethylaniline, Benzenamine, N,N,2,6-tetramethyl-, 2,6-Dimethyl-N,N-dimethylaniline, N,N,2,6-Tetramethylbenzenamine, InChI=1/C10H15N/c1-8-6-5-7-9(2)10(8)11(3)4/h5-7H,1-4H, SCVRZFQSPISLTD-UHFFFAOYSA-N, 2,6-Xylidine, N,N-dimethyl-, N,N-Dimethyl-2,6-dimethylaniline, aniline, N,N,2,6-tetramethyl-, 2,6,N,N-Tetramethylaniline