CAS 769-11-9 appears in our catalog under these names: 2–Chloro–6–nitroaniline, 2-Chloro-6-nitroaniline 97%, 2-Chloro-6-nitroaniline, 97%, 97%, 2-Chloro-6-nitroaniline, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 500g, 1000g, 1kg.
2-chloro-6-nitroaniline (CAS 769-11-9) is a chemical compound with the molecular formula C6H5ClN2O2 and a molecular weight of 172.57 g/mol. IUPAC name: 2-chloro-6-nitroaniline. InChIKey: VOTXWUCYIOPNNR-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O2 |
|---|---|
| Molecular weight | 172.57 g/mol |
| IUPAC name | 2-chloro-6-nitroaniline |
| InChIKey | VOTXWUCYIOPNNR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)