CAS 769-56-2 appears in our catalog under these names: 4,6-Dibromobenzo(c)(1,2,5)oxadiazole, 95%, 4,6-Dibromo-2,1,3-benzoxadiazole, 4,6-dibromobenzo[c][1,2,5]oxadiazole, 95%, 95%, 4,6-Dibromo-2,1,3-benzoxadiazole, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg, 500mg, 2.5g, 5g.
4,6-dibromo-2,1,3-benzoxadiazole (CAS 769-56-2) is a chemical compound with the molecular formula C6H2Br2N2O and a molecular weight of 277.90 g/mol. IUPAC name: 4,6-dibromo-2,1,3-benzoxadiazole. InChIKey: CWWZUAXJZKSULT-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2N2O |
|---|---|
| Molecular weight | 277.90 g/mol |
| IUPAC name | 4,6-dibromo-2,1,3-benzoxadiazole |
| InChIKey | CWWZUAXJZKSULT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=NON=C21)Br)Br |
Computed by PubChem (NCBI)