CAS 7691-02-3 appears in our catalog under these names: 1,1,3,3-Tetramethyl-1,3-divinyldisilazane, 95%, 1,3-Divinyl-1,1,3,3-tetramethyldisilazane, >95.0%(GC), 1,3-Divinyltetramethyldisilazane, 95%. Offered by: Combi-blocks, TCI, Fluorochem. Available pack sizes: 25g, 1g, 100g, 500g, 5g, 5ml, 25ml, 50g.
[[[ethenyl(dimethyl)silyl]amino]-dimethylsilyl]ethene (CAS 7691-02-3) is a chemical compound with the molecular formula C8H19NSi2 and a molecular weight of 185.41 g/mol. IUPAC name: [[[ethenyl(dimethyl)silyl]amino]-dimethylsilyl]ethene. InChIKey: WYUIWUCVZCRTRH-UHFFFAOYSA-N.
| Molecular formula | C8H19NSi2 |
|---|---|
| Molecular weight | 185.41 g/mol |
| IUPAC name | [[[ethenyl(dimethyl)silyl]amino]-dimethylsilyl]ethene |
| InChIKey | WYUIWUCVZCRTRH-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C=C)N[Si](C)(C)C=C |
Computed by PubChem (NCBI)