CAS 769124-82-5 is the registry number for Bis(pyridin-4-ylmethyl) pyridine-2,6-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(pyridin-4-ylmethyl) pyridine-2,6-dicarboxylate (CAS 769124-82-5) is a chemical compound with the molecular formula C19H15N3O4 and a molecular weight of 349.3 g/mol. IUPAC name: bis(pyridin-4-ylmethyl) pyridine-2,6-dicarboxylate. InChIKey: QVCOVURSDGBJJN-UHFFFAOYSA-N.
| Molecular formula | C19H15N3O4 |
|---|---|
| Molecular weight | 349.3 g/mol |
| IUPAC name | bis(pyridin-4-ylmethyl) pyridine-2,6-dicarboxylate |
| InChIKey | QVCOVURSDGBJJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(=O)OCC2=CC=NC=C2)C(=O)OCC3=CC=NC=C3 |
Computed by PubChem (NCBI)