CAS 769169-13-3 is the registry number for (2S,3R)-2-Amino-5,5,5-trifluoro-3-methylpentanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3R)-2-amino-5,5,5-trifluoro-3-methylpentanoic acid (CAS 769169-13-3) is a chemical compound with the molecular formula C6H10F3NO2 and a molecular weight of 185.14 g/mol. IUPAC name: (2S,3R)-2-amino-5,5,5-trifluoro-3-methylpentanoic acid. InChIKey: IISHLMOFSAYIEX-DMTCNVIQSA-N.
| Molecular formula | C6H10F3NO2 |
|---|---|
| Molecular weight | 185.14 g/mol |
| IUPAC name | (2S,3R)-2-amino-5,5,5-trifluoro-3-methylpentanoic acid |
| InChIKey | IISHLMOFSAYIEX-DMTCNVIQSA-N |
| SMILES | C[C@H](CC(F)(F)F)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)