CAS 769169-27-9 appears in our catalog under these names: Begacestat, 99%, Begacestat, Begacestat, 99.29%, Begacestat (Standard). Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 2mg, 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg.
5-chloro-N-[(2S)-4,4,4-trifluoro-1-hydroxy-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide (CAS 769169-27-9) is a chemical compound with the molecular formula C9H8ClF6NO3S2 and a molecular weight of 391.7 g/mol. IUPAC name: 5-chloro-N-[(2S)-4,4,4-trifluoro-1-hydroxy-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide. InChIKey: PSXOKXJMVRSARX-SCSAIBSYSA-N.
| Molecular formula | C9H8ClF6NO3S2 |
|---|---|
| Molecular weight | 391.7 g/mol |
| IUPAC name | 5-chloro-N-[(2S)-4,4,4-trifluoro-1-hydroxy-3-(trifluoromethyl)butan-2-yl]thiophene-2-sulfonamide |
| InChIKey | PSXOKXJMVRSARX-SCSAIBSYSA-N |
| SMILES | C1=C(SC(=C1)Cl)S(=O)(=O)N[C@H](CO)C(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)