CAS 769169-74-6 is the registry number for 4,4,4-Trifluoro-2-(2,2,2-trifluoroethyl)butanal, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butanal (CAS 769169-74-6) is a chemical compound with the molecular formula C6H6F6O and a molecular weight of 208.10 g/mol. IUPAC name: 4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butanal. InChIKey: LPBOCGULFQLXAH-UHFFFAOYSA-N.
| Molecular formula | C6H6F6O |
|---|---|
| Molecular weight | 208.10 g/mol |
| IUPAC name | 4,4,4-trifluoro-2-(2,2,2-trifluoroethyl)butanal |
| InChIKey | LPBOCGULFQLXAH-UHFFFAOYSA-N |
| SMILES | C(C(CC(F)(F)F)C=O)C(F)(F)F |
Computed by PubChem (NCBI)