CAS 7693-13-2 appears in our catalog under these names: Calcium citrate, 95%, Calcium citrate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1kg, 500g, 100g, 25g.
Calcium 3-carboxy-3-hydroxypentanedioate (CAS 7693-13-2) is a chemical compound with the molecular formula C6H6CaO7 and a molecular weight of 230.19 g/mol. IUPAC name: calcium 3-carboxy-3-hydroxypentanedioate. InChIKey: PFKGDYCESFRMAP-UHFFFAOYSA-L.
| Molecular formula | C6H6CaO7 |
|---|---|
| Molecular weight | 230.19 g/mol |
| IUPAC name | calcium 3-carboxy-3-hydroxypentanedioate |
| InChIKey | PFKGDYCESFRMAP-UHFFFAOYSA-L |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)O)O.[Ca+2] |
Computed by PubChem (NCBI)