CAS 769908-13-6 is the registry number for Pitavastatin (3R,5R)-Isomer. Offered by: Chemat Brand. Available pack sizes: on request.
(E,3R,5R)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoic acid (CAS 769908-13-6) is a chemical compound with the molecular formula C25H24FNO4 and a molecular weight of 421.5 g/mol. IUPAC name: (E,3R,5R)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoic acid. InChIKey: VGYFMXBACGZSIL-FUTHQCHMSA-N.
| Molecular formula | C25H24FNO4 |
|---|---|
| Molecular weight | 421.5 g/mol |
| IUPAC name | (E,3R,5R)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoic acid |
| InChIKey | VGYFMXBACGZSIL-FUTHQCHMSA-N |
| SMILES | C1CC1C2=NC3=CC=CC=C3C(=C2/C=C/[C@@H](C[C@H](CC(=O)O)O)O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)