CAS 769922-77-2 is the registry number for Benzyl (S)-(1-(1H-benzo[d][1,2,3]triazol-1-yl)-1-oxo-3-phenylpropan-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[(2S)-1-(benzotriazol-1-yl)-1-oxo-3-phenylpropan-2-yl]carbamate (CAS 769922-77-2) is a chemical compound with the molecular formula C23H20N4O3 and a molecular weight of 400.4 g/mol. IUPAC name: benzyl N-[(2S)-1-(benzotriazol-1-yl)-1-oxo-3-phenylpropan-2-yl]carbamate. InChIKey: YKOJLKRZEWWYIH-FQEVSTJZSA-N.
| Molecular formula | C23H20N4O3 |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | benzyl N-[(2S)-1-(benzotriazol-1-yl)-1-oxo-3-phenylpropan-2-yl]carbamate |
| InChIKey | YKOJLKRZEWWYIH-FQEVSTJZSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N2C3=CC=CC=C3N=N2)NC(=O)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)